Tricyclo[3.3.1.13,7]decane, 1-(4-ethynylphenyl)-
1-(4-Ethynylphenyl)adamantane
CAS: 219831-45-5
Molecular Formula: C18H20
Tricyclo[3.3.1.13,7]decane, 1-(4-ethynylphenyl)- - Names and Identifiers
| Name | 1-(4-Ethynylphenyl)adamantane |
| Synonyms | 4-AdaMantyl-ethynylbenzene 1-(4-Ethynylphenyl)adamantane Tricyclo[3.3.1.13,7]decane, 1-(4-ethynylphenyl)- |
| CAS | 219831-45-5 |
| InChI | InChI=1S/C18H20/c1-2-13-3-5-17(6-4-13)18-10-14-7-15(11-18)9-16(8-14)12-18/h1,3-6,14-16H,7-12H2 |
Tricyclo[3.3.1.13,7]decane, 1-(4-ethynylphenyl)- - Physico-chemical Properties
| Molecular Formula | C18H20 |
| Molar Mass | 236.35 |
| Storage Condition | 2-8°C |
| Sensitive | IRRITANT |
| MDL | MFCD23135429 |
Tricyclo[3.3.1.13,7]decane, 1-(4-ethynylphenyl)- - Introduction
1-(4-Ethynylphenyl)adamantane is a compound with the chemical formula C22H20. The following is an introduction to its nature, use, preparation and safety information:
Nature:
1-(4-Ethynylphenyl)adamantane is a solid with a white crystalline form. It is stable at room temperature and insoluble in water, but soluble in organic solvents such as ethanol and dimethylformamide. It is sensitive to light and should be stored away from light.
Use:
1-(4-Ethynylphenyl)adamantane has certain applications in the field of chemistry and medicine. It can be used as a synthetic chemical reagent, such as a catalyst or a ligand. It can also be used in reactions in organic synthesis, such as the construction of chain compounds or ring-opening reactions.
Method:
1-(4-Ethynylphenyl)adamantane can be prepared by chemical synthesis. A common preparation method is to react an adamantyl compound with a phenylethynyl compound to form 1-(4-Ethynylphenyl)adamantane through a carbon-carbon bond. The synthesis process requires certain chemical synthesis techniques and experimental conditions.
Safety Information:
Safety information for 1-(4-Ethynylphenyl)adamantane is limited. However, as a chemical agent, it may have certain carcinogenic, teratogenic or toxic effects. Therefore, when using, should follow the relevant safety procedures, and take appropriate personal protective measures, such as wearing protective gloves and glasses. In addition, it should be kept away from fire and high temperature, and stored properly. If there is any unclear or security-related questions, you should consult a professional or refer to the appropriate information.
Nature:
1-(4-Ethynylphenyl)adamantane is a solid with a white crystalline form. It is stable at room temperature and insoluble in water, but soluble in organic solvents such as ethanol and dimethylformamide. It is sensitive to light and should be stored away from light.
Use:
1-(4-Ethynylphenyl)adamantane has certain applications in the field of chemistry and medicine. It can be used as a synthetic chemical reagent, such as a catalyst or a ligand. It can also be used in reactions in organic synthesis, such as the construction of chain compounds or ring-opening reactions.
Method:
1-(4-Ethynylphenyl)adamantane can be prepared by chemical synthesis. A common preparation method is to react an adamantyl compound with a phenylethynyl compound to form 1-(4-Ethynylphenyl)adamantane through a carbon-carbon bond. The synthesis process requires certain chemical synthesis techniques and experimental conditions.
Safety Information:
Safety information for 1-(4-Ethynylphenyl)adamantane is limited. However, as a chemical agent, it may have certain carcinogenic, teratogenic or toxic effects. Therefore, when using, should follow the relevant safety procedures, and take appropriate personal protective measures, such as wearing protective gloves and glasses. In addition, it should be kept away from fire and high temperature, and stored properly. If there is any unclear or security-related questions, you should consult a professional or refer to the appropriate information.
Last Update：2024-04-09 20:52:54
![Tricyclo[3.3.1.13,7]decane, 1-(4-ethynylphenyl)-](http://res.chembk.com/assets/str/2d/2/21/219831-45-5.png)